C15H21N3O2S — CID 107323848
3-amino-N-(5-hydroxypentyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide (PubChem CID 107323848) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-amino-N-(5-hydroxypentyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(5-hydroxypentyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107323848 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-amino-N-(5-hydroxypentyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide |
| SMILES | Cc1cc2sc(C(=O)NCCCCCO)c(N)c2c(C)n1 |
| InChI | InChI=1S/C15H21N3O2S/c1-9-8-11-12(10(2)18-9)13(16)14(21-11)15(20)17-6-4-3-5-7-19/h8,19H,3-7,16H2,1-2H3,(H,17,20) |
| InChIKey | BAKBUOYMAVLPDZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|