C14H20N4O2S — CID 107323862
5-amino-N-(5-hydroxypentyl)-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide (PubChem CID 107323862) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-amino-N-(5-hydroxypentyl)-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide.
| Compound Name | 5-amino-N-(5-hydroxypentyl)-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 107323862 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-amino-N-(5-hydroxypentyl)-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide |
| SMILES | Cc1nnc2sc(C(=O)NCCCCCO)c(N)c2c1C |
| InChI | InChI=1S/C14H20N4O2S/c1-8-9(2)17-18-14-10(8)11(15)12(21-14)13(20)16-6-4-3-5-7-19/h19H,3-7,15H2,1-2H3,(H,16,20) |
| InChIKey | LVRUGVVCUXICBM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|