C12H12N4O4S — CID 107325280
3-amino-1-(4-nitro-1,3-benzothiazol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 107325280) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 3-amino-1-(4-nitro-1,3-benzothiazol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(4-nitro-1,3-benzothiazol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107325280 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-amino-1-(4-nitro-1,3-benzothiazol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(c2ccc3scnc3c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H12N4O4S/c13-12(11(17)18)3-4-15(5-12)7-1-2-8-9(14-6-21-8)10(7)16(19)20/h1-2,6H,3-5,13H2,(H,17,18) |
| InChIKey | VHESGQQZBWRAEN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|