C14H18N4O2S — CID 115305704
N,4-dimethyl-1-(4-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine (PubChem CID 115305704) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N,4-dimethyl-1-(4-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine.
| Compound Name | N,4-dimethyl-1-(4-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 115305704 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N,4-dimethyl-1-(4-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine |
| SMILES | CNC1(C)CCN(c2ccc3scnc3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H18N4O2S/c1-14(15-2)5-7-17(8-6-14)10-3-4-11-12(16-9-21-11)13(10)18(19)20/h3-4,9,15H,5-8H2,1-2H3 |
| InChIKey | CSUSMTVJWLBYAX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|