C13H15N3O2S2 — CID 80724441
N-[(2-methylthiolan-2-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine (PubChem CID 80724441) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 80724441 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine |
| SMILES | CC1(CNc2ccc3scnc3c2[N+](=O)[O-])CCCS1 |
| InChI | InChI=1S/C13H15N3O2S2/c1-13(5-2-6-20-13)7-14-9-3-4-10-11(15-8-19-10)12(9)16(17)18/h3-4,8,14H,2,5-7H2,1H3 |
| InChIKey | XUDCAABLOSTIFW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|