C14H16ClNO4 — CID 10732793
(2S,4R)-2-amino-4-[(E)-3-(3-chlorophenyl)prop-2-enyl]pentanedioic acid (PubChem CID 10732793) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-[(E)-3-(3-chlorophenyl)prop-2-enyl]pentanedioic acid.
| Compound Name | (2S,4R)-2-amino-4-[(E)-3-(3-chlorophenyl)prop-2-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 10732793 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2S,4R)-2-amino-4-[(E)-3-(3-chlorophenyl)prop-2-enyl]pentanedioic acid |
| SMILES | N[C@@H](C[C@@H](C/C=C/c1cccc(Cl)c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16ClNO4/c15-11-6-2-4-9(7-11)3-1-5-10(13(17)18)8-12(16)14(19)20/h1-4,6-7,10,12H,5,8,16H2,(H,17,18)(H,19,20)/b3-1+/t10-,12+/m1/s1 |
| InChIKey | IGCFWEAQYYVTCO-NHPSYUHZSA-N |
| XLogP | 2.25 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |