C12H12ClNO3 — CID 13041001
(2E)-2-[(E)-3-(3-chlorophenyl)prop-2-enoxy]iminopropanoic acid (PubChem CID 13041001) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is (2E)-2-[(E)-3-(3-chlorophenyl)prop-2-enoxy]iminopropanoic acid.
| Compound Name | (2E)-2-[(E)-3-(3-chlorophenyl)prop-2-enoxy]iminopropanoic acid |
|---|---|
| PubChem CID | 13041001 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (2E)-2-[(E)-3-(3-chlorophenyl)prop-2-enoxy]iminopropanoic acid |
| SMILES | C/C(=N\OC/C=C/c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H12ClNO3/c1-9(12(15)16)14-17-7-3-5-10-4-2-6-11(13)8-10/h2-6,8H,7H2,1H3,(H,15,16)/b5-3+,14-9+ |
| InChIKey | OKIBIDWYXSYAHQ-HNBAAQFOSA-N |
| XLogP | 2.83 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|