C23H28N2O6 — CID 88722895
2-[3-(3-methoxyphenyl)prop-2-enoxyimino]propanoic acid;O-[3-(3-methoxyphenyl)prop-2-enyl]hydroxylamine (PubChem CID 88722895) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)prop-2-enoxyimino]propanoic acid;O-[3-(3-methoxyphenyl)prop-2-enyl]hydroxylamine.
| Compound Name | 2-[3-(3-methoxyphenyl)prop-2-enoxyimino]propanoic acid;O-[3-(3-methoxyphenyl)prop-2-enyl]hydroxylamine |
|---|---|
| PubChem CID | 88722895 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)prop-2-enoxyimino]propanoic acid;O-[3-(3-methoxyphenyl)prop-2-enyl]hydroxylamine |
| SMILES | COc1cccc(C=CCON)c1.COc1cccc(C=CCON=C(C)C(=O)O)c1 |
| InChI | InChI=1S/C13H15NO4.C10H13NO2/c1-10(13(15)16)14-18-8-4-6-11-5-3-7-12(9-11)17-2;1-12-10-6-2-4-9(8-10)5-3-7-13-11/h3-7,9H,8H2,1-2H3,(H,15,16);2-6,8H,7,11H2,1H3 |
| InChIKey | DTSOZCZXDBFPIG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|