C21H25ClN2O4 — CID 88722523
2-(3-phenylprop-2-enoxyimino)propanoic acid;O-(3-phenylprop-2-enyl)hydroxylamine;hydrochloride (PubChem CID 88722523) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-(3-phenylprop-2-enoxyimino)propanoic acid;O-(3-phenylprop-2-enyl)hydroxylamine;hydrochloride.
| Compound Name | 2-(3-phenylprop-2-enoxyimino)propanoic acid;O-(3-phenylprop-2-enyl)hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 88722523 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-(3-phenylprop-2-enoxyimino)propanoic acid;O-(3-phenylprop-2-enyl)hydroxylamine;hydrochloride |
| SMILES | CC(=NOCC=Cc1ccccc1)C(=O)O.Cl.NOCC=Cc1ccccc1 |
| InChI | InChI=1S/C12H13NO3.C9H11NO.ClH/c1-10(12(14)15)13-16-9-5-8-11-6-3-2-4-7-11;10-11-8-4-7-9-5-2-1-3-6-9;/h2-8H,9H2,1H3,(H,14,15);1-7H,8,10H2;1H |
| InChIKey | RKSZAOLBJDITOQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|