C23H29ClN2O4 — CID 173425848
2-(2-methyl-3-phenylprop-2-enoxy)iminopropanoic acid;O-(2-methyl-3-phenylprop-2-enyl)hydroxylamine;hydrochloride (PubChem CID 173425848) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is 2-(2-methyl-3-phenylprop-2-enoxy)iminopropanoic acid;O-(2-methyl-3-phenylprop-2-enyl)hydroxylamine;hydrochloride.
| Compound Name | 2-(2-methyl-3-phenylprop-2-enoxy)iminopropanoic acid;O-(2-methyl-3-phenylprop-2-enyl)hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 173425848 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-(2-methyl-3-phenylprop-2-enoxy)iminopropanoic acid;O-(2-methyl-3-phenylprop-2-enyl)hydroxylamine;hydrochloride |
| SMILES | CC(=Cc1ccccc1)CON.CC(=Cc1ccccc1)CON=C(C)C(=O)O.Cl |
| InChI | InChI=1S/C13H15NO3.C10H13NO.ClH/c1-10(8-12-6-4-3-5-7-12)9-17-14-11(2)13(15)16;1-9(8-12-11)7-10-5-3-2-4-6-10;/h3-8H,9H2,1-2H3,(H,15,16);2-7H,8,11H2,1H3;1H |
| InChIKey | IUYJLPXUAVZKEA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|