C9H16N2O4 — CID 88723475
(2E)-2-prop-2-enoxyiminopropanoic acid;O-prop-2-enylhydroxylamine (PubChem CID 88723475) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2E)-2-prop-2-enoxyiminopropanoic acid;O-prop-2-enylhydroxylamine.
| Compound Name | (2E)-2-prop-2-enoxyiminopropanoic acid;O-prop-2-enylhydroxylamine |
|---|---|
| PubChem CID | 88723475 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2E)-2-prop-2-enoxyiminopropanoic acid;O-prop-2-enylhydroxylamine |
| SMILES | C=CCO/N=C(\C)C(=O)O.C=CCON |
| InChI | InChI=1S/C6H9NO3.C3H7NO/c1-3-4-10-7-5(2)6(8)9;1-2-3-5-4/h3H,1,4H2,2H3,(H,8,9);2H,1,3-4H2/b7-5+; |
| InChIKey | OMNSZEJPEMULDC-GZOLSCHFSA-N |
| XLogP | 0.71 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|