About disilver;2-prop-2-enoxyiminopropanedioate
disilver;2-prop-2-enoxyiminopropanedioate (PubChem CID 118523479) has the molecular formula C6H5Ag2NO5
and a molecular weight of 386.84 g/mol. Its IUPAC name is disilver;2-prop-2-enoxyiminopropanedioate.
Molecular Properties
| Compound Name | disilver;2-prop-2-enoxyiminopropanedioate |
| PubChem CID | 118523479 |
| Molecular Formula | C6H5Ag2NO5 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 384.83 |
| IUPAC Name | disilver;2-prop-2-enoxyiminopropanedioate |
| SMILES | C=CCON=C(C(=O)[O-])C(=O)[O-].[Ag+].[Ag+] |
| InChI | InChI=1S/C6H7NO5.2Ag/c1-2-3-12-7-4(5(8)9)6(10)11;;/h2H,1,3H2,(H,8,9)(H,10,11);;/q;2*+1/p-2 |
| InChIKey | FABVZIQAYIJZGH-UHFFFAOYSA-L |
| XLogP | -2.96 |
| TPSA | 101.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disilver;2-prop-2-enoxyiminopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disilver;2-prop-2-enoxyiminopropanedioate?
The IUPAC name of disilver;2-prop-2-enoxyiminopropanedioate (CID 118523479) is disilver;2-prop-2-enoxyiminopropanedioate.
What is the SMILES notation for disilver;2-prop-2-enoxyiminopropanedioate?
The canonical SMILES for disilver;2-prop-2-enoxyiminopropanedioate is C=CCON=C(C(=O)[O-])C(=O)[O-].[Ag+].[Ag+].
What is the InChIKey of disilver;2-prop-2-enoxyiminopropanedioate?
The InChIKey is FABVZIQAYIJZGH-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7NO5.2Ag/c1-2-3-12-7-4(5(8)9)6(10)11;;/h2H,1,3H2,(H,8,9)(H,10,11);;/q;2*+1/p-2.
What are the key properties of disilver;2-prop-2-enoxyiminopropanedioate?
disilver;2-prop-2-enoxyiminopropanedioate has a molecular weight of 386.84 g/mol, XLogP of -2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disilver;2-prop-2-enoxyiminopropanedioate is sourced from PubChem (CID 118523479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).