About 2-prop-2-enoxyiminopropanedioate;silver
2-prop-2-enoxyiminopropanedioate;silver (PubChem CID 118523482) has the molecular formula C6H5AgNO5-2
and a molecular weight of 278.98 g/mol. Its IUPAC name is 2-prop-2-enoxyiminopropanedioate;silver.
Molecular Properties
| Compound Name | 2-prop-2-enoxyiminopropanedioate;silver |
| PubChem CID | 118523482 |
| Molecular Formula | C6H5AgNO5-2 |
| Molecular Weight | 278.98 g/mol |
| Exact Mass | 277.92 |
| IUPAC Name | 2-prop-2-enoxyiminopropanedioate;silver |
| SMILES | C=CCON=C(C(=O)[O-])C(=O)[O-].[Ag] |
| InChI | InChI=1S/C6H7NO5.Ag/c1-2-3-12-7-4(5(8)9)6(10)11;/h2H,1,3H2,(H,8,9)(H,10,11);/p-2 |
| InChIKey | HGEYMMYGKSMEEH-UHFFFAOYSA-L |
| XLogP | -2.96 |
| TPSA | 101.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.98 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoxyiminopropanedioate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoxyiminopropanedioate;silver?
The IUPAC name of 2-prop-2-enoxyiminopropanedioate;silver (CID 118523482) is 2-prop-2-enoxyiminopropanedioate;silver.
What is the SMILES notation for 2-prop-2-enoxyiminopropanedioate;silver?
The canonical SMILES for 2-prop-2-enoxyiminopropanedioate;silver is C=CCON=C(C(=O)[O-])C(=O)[O-].[Ag].
What is the InChIKey of 2-prop-2-enoxyiminopropanedioate;silver?
The InChIKey is HGEYMMYGKSMEEH-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7NO5.Ag/c1-2-3-12-7-4(5(8)9)6(10)11;/h2H,1,3H2,(H,8,9)(H,10,11);/p-2.
What are the key properties of 2-prop-2-enoxyiminopropanedioate;silver?
2-prop-2-enoxyiminopropanedioate;silver has a molecular weight of 278.98 g/mol, XLogP of -2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoxyiminopropanedioate;silver is sourced from PubChem (CID 118523482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).