C14H18O5S — CID 10732823
methyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate (PubChem CID 10732823) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate.
| Compound Name | methyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 10732823 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | methyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate |
| SMILES | COC(=O)CC(=O)C[C@H](O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O5S/c1-10-3-5-13(6-4-10)20(18)9-12(16)7-11(15)8-14(17)19-2/h3-6,12,16H,7-9H2,1-2H3/t12-,20+/m0/s1 |
| InChIKey | NUKVKHGBBUPNRW-FKIZINRSSA-N |
| XLogP | 0.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|