C17H24O5S — CID 11013243
tert-butyl 4-(hydroxymethyl)-3-(4-methylphenyl)sulfonylpent-4-enoate (PubChem CID 11013243) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is tert-butyl 4-(hydroxymethyl)-3-(4-methylphenyl)sulfonylpent-4-enoate.
| Compound Name | tert-butyl 4-(hydroxymethyl)-3-(4-methylphenyl)sulfonylpent-4-enoate |
|---|---|
| PubChem CID | 11013243 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | tert-butyl 4-(hydroxymethyl)-3-(4-methylphenyl)sulfonylpent-4-enoate |
| SMILES | C=C(CO)C(CC(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O5S/c1-12-6-8-14(9-7-12)23(20,21)15(13(2)11-18)10-16(19)22-17(3,4)5/h6-9,15,18H,2,10-11H2,1,3-5H3 |
| InChIKey | DPHDHBQWSQQRGC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|