C12H21F3O3Si — CID 10732826
(3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)oxolan-2-one (PubChem CID 10732826) has the molecular formula C12H21F3O3Si and a molecular weight of 298.38 g/mol. Its IUPAC name is (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)oxolan-2-one.
| Compound Name | (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10732826 |
| Molecular Formula | C12H21F3O3Si |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@@H](C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C12H21F3O3Si/c1-11(2,3)19(4,5)17-7-8-6-9(10(16)18-8)12(13,14)15/h8-9H,6-7H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | ABZGSYOGSAEDSI-DTWKUNHWSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|