C11H21FO3Si — CID 10901006
(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-one (PubChem CID 10901006) has the molecular formula C11H21FO3Si and a molecular weight of 248.37 g/mol. Its IUPAC name is (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-one.
| Compound Name | (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-one |
|---|---|
| PubChem CID | 10901006 |
| Molecular Formula | C11H21FO3Si |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](F)C(=O)O1 |
| InChI | InChI=1S/C11H21FO3Si/c1-11(2,3)16(4,5)14-7-8-6-9(12)10(13)15-8/h8-9H,6-7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | NRLOOKJAOFWAOM-IUCAKERBSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|