C12H21F3O3Si — CID 54542353
5-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]oxolan-2-one (PubChem CID 54542353) has the molecular formula C12H21F3O3Si and a molecular weight of 298.38 g/mol. Its IUPAC name is 5-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]oxolan-2-one.
| Compound Name | 5-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]oxolan-2-one |
|---|---|
| PubChem CID | 54542353 |
| Molecular Formula | C12H21F3O3Si |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(C1CCC(=O)O1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3O3Si/c1-11(2,3)19(4,5)18-10(12(13,14)15)8-6-7-9(16)17-8/h8,10H,6-7H2,1-5H3 |
| InChIKey | ZECUIVYSVFRLMA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|