About 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one
5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one (PubChem CID 91750941) has the molecular formula C12H23BrO3Si
and a molecular weight of 323.30 g/mol. Its IUPAC name is 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one.
Molecular Properties
| Compound Name | 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one |
| PubChem CID | 91750941 |
| Molecular Formula | C12H23BrO3Si |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(CBr)C1CCC(=O)O1 |
| InChI | InChI=1S/C12H23BrO3Si/c1-12(2,3)17(4,5)16-10(8-13)9-6-7-11(14)15-9/h9-10H,6-8H2,1-5H3 |
| InChIKey | DTWCYAFYPUNCJW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one?
The IUPAC name of 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one (CID 91750941) is 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one.
What is the SMILES notation for 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one?
The canonical SMILES for 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one is CC(C)(C)[Si](C)(C)OC(CBr)C1CCC(=O)O1.
What is the InChIKey of 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one?
The InChIKey is DTWCYAFYPUNCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrO3Si/c1-12(2,3)17(4,5)16-10(8-13)9-6-7-11(14)15-9/h9-10H,6-8H2,1-5H3.
What are the key properties of 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one?
5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one has a molecular weight of 323.30 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one is sourced from PubChem (CID 91750941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).