C15H15NO6 — CID 10733360
methyl (E)-3-[(2R,3R)-2-formyl-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxyprop-2-enoate (PubChem CID 10733360) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl (E)-3-[(2R,3R)-2-formyl-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxyprop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,3R)-2-formyl-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 10733360 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | methyl (E)-3-[(2R,3R)-2-formyl-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxyprop-2-enoate |
| SMILES | COC(=O)/C=C/O[C@H]1C(=O)N(c2ccc(OC)cc2)[C@H]1C=O |
| InChI | InChI=1S/C15H15NO6/c1-20-11-5-3-10(4-6-11)16-12(9-17)14(15(16)19)22-8-7-13(18)21-2/h3-9,12,14H,1-2H3/b8-7+/t12-,14+/m0/s1 |
| InChIKey | RBHIFNDFNNXSPH-IRORGTOCSA-N |
| XLogP | 0.68 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|