C12H10BrF3N2OS — CID 107335996
3-bromo-N-[1-(1,3-thiazol-5-yl)ethyl]-4-(trifluoromethoxy)aniline (PubChem CID 107335996) has the molecular formula C12H10BrF3N2OS and a molecular weight of 367.19 g/mol. Its IUPAC name is 3-bromo-N-[1-(1,3-thiazol-5-yl)ethyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-[1-(1,3-thiazol-5-yl)ethyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107335996 |
| Molecular Formula | C12H10BrF3N2OS |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 3-bromo-N-[1-(1,3-thiazol-5-yl)ethyl]-4-(trifluoromethoxy)aniline |
| SMILES | CC(Nc1ccc(OC(F)(F)F)c(Br)c1)c1cncs1 |
| InChI | InChI=1S/C12H10BrF3N2OS/c1-7(11-5-17-6-20-11)18-8-2-3-10(9(13)4-8)19-12(14,15)16/h2-7,18H,1H3 |
| InChIKey | HBGRUPHNPHDNGI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|