C12H13IN2S — CID 115917182
3-iodo-4-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]aniline (PubChem CID 115917182) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 3-iodo-4-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]aniline.
| Compound Name | 3-iodo-4-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115917182 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 3-iodo-4-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]aniline |
| SMILES | Cc1ccc(NC(C)c2cncs2)cc1I |
| InChI | InChI=1S/C12H13IN2S/c1-8-3-4-10(5-11(8)13)15-9(2)12-6-14-7-16-12/h3-7,9,15H,1-2H3 |
| InChIKey | DPYHQKDEVCMVLM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|