C12H14N4OS — CID 115928663
[3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]urea (PubChem CID 115928663) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is [3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]urea.
| Compound Name | [3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]urea |
|---|---|
| PubChem CID | 115928663 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]urea |
| SMILES | CC(Nc1cccc(NC(N)=O)c1)c1cncs1 |
| InChI | InChI=1S/C12H14N4OS/c1-8(11-6-14-7-18-11)15-9-3-2-4-10(5-9)16-12(13)17/h2-8,15H,1H3,(H3,13,16,17) |
| InChIKey | WJXBMBFOSVRGCE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |