C14H18N2OS — CID 115922548
4-propoxy-N-[1-(1,3-thiazol-5-yl)ethyl]aniline (PubChem CID 115922548) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-propoxy-N-[1-(1,3-thiazol-5-yl)ethyl]aniline.
| Compound Name | 4-propoxy-N-[1-(1,3-thiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115922548 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-propoxy-N-[1-(1,3-thiazol-5-yl)ethyl]aniline |
| SMILES | CCCOc1ccc(NC(C)c2cncs2)cc1 |
| InChI | InChI=1S/C14H18N2OS/c1-3-8-17-13-6-4-12(5-7-13)16-11(2)14-9-15-10-18-14/h4-7,9-11,16H,3,8H2,1-2H3 |
| InChIKey | SKICFKRHMWCMAS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|