C14H11Cl2NOS — CID 10733855
1-chloro-1-(2-chlorophenyl)-2-methyl-1,2-benzothiazol-3-one (PubChem CID 10733855) has the molecular formula C14H11Cl2NOS and a molecular weight of 312.22 g/mol. Its IUPAC name is 1-chloro-1-(2-chlorophenyl)-2-methyl-1,2-benzothiazol-3-one.
| Compound Name | 1-chloro-1-(2-chlorophenyl)-2-methyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 10733855 |
| Molecular Formula | C14H11Cl2NOS |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 1-chloro-1-(2-chlorophenyl)-2-methyl-1,2-benzothiazol-3-one |
| SMILES | CN1C(=O)c2ccccc2S1(Cl)c1ccccc1Cl |
| InChI | InChI=1S/C14H11Cl2NOS/c1-17-14(18)10-6-2-4-8-12(10)19(17,16)13-9-5-3-7-11(13)15/h2-9H,1H3 |
| InChIKey | UBVVVNVFJSTFRW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |