C12H15N7S2 — CID 10734559
5-amino-N-methyl-3-[4-(methylcarbamothioylamino)phenyl]-1,2,4-triazole-1-carbothioamide (PubChem CID 10734559) has the molecular formula C12H15N7S2 and a molecular weight of 321.44 g/mol. Its IUPAC name is 5-amino-N-methyl-3-[4-(methylcarbamothioylamino)phenyl]-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-N-methyl-3-[4-(methylcarbamothioylamino)phenyl]-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10734559 |
| Molecular Formula | C12H15N7S2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-amino-N-methyl-3-[4-(methylcarbamothioylamino)phenyl]-1,2,4-triazole-1-carbothioamide |
| SMILES | CNC(=S)Nc1ccc(-c2nc(N)n(C(=S)NC)n2)cc1 |
| InChI | InChI=1S/C12H15N7S2/c1-14-11(20)16-8-5-3-7(4-6-8)9-17-10(13)19(18-9)12(21)15-2/h3-6H,1-2H3,(H,15,21)(H2,13,17,18)(H2,14,16,20) |
| InChIKey | YCQOPOIWRUBIBC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|