C11H6N4O4S — CID 107346999
4-nitro-1-thieno[3,2-c]pyridin-4-ylpyrazole-3-carboxylic acid (PubChem CID 107346999) has the molecular formula C11H6N4O4S and a molecular weight of 290.26 g/mol. Its IUPAC name is 4-nitro-1-thieno[3,2-c]pyridin-4-ylpyrazole-3-carboxylic acid.
| Compound Name | 4-nitro-1-thieno[3,2-c]pyridin-4-ylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107346999 |
| Molecular Formula | C11H6N4O4S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 4-nitro-1-thieno[3,2-c]pyridin-4-ylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2nccc3sccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H6N4O4S/c16-11(17)9-7(15(18)19)5-14(13-9)10-6-2-4-20-8(6)1-3-12-10/h1-5H,(H,16,17) |
| InChIKey | QZUIRTOZQHKWDS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|