C9H8N4O4S — CID 107347128
1-(4-ethyl-1,3-thiazol-2-yl)-4-nitropyrazole-3-carboxylic acid (PubChem CID 107347128) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-thiazol-2-yl)-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-(4-ethyl-1,3-thiazol-2-yl)-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107347128 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-(4-ethyl-1,3-thiazol-2-yl)-4-nitropyrazole-3-carboxylic acid |
| SMILES | CCc1csc(-n2cc([N+](=O)[O-])c(C(=O)O)n2)n1 |
| InChI | InChI=1S/C9H8N4O4S/c1-2-5-4-18-9(10-5)12-3-6(13(16)17)7(11-12)8(14)15/h3-4H,2H2,1H3,(H,14,15) |
| InChIKey | NLSJVFKLZHDUSF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|