C12H14N4O4S — CID 107345566
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-nitropyrazole-3-carboxylic acid (PubChem CID 107345566) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107345566 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4-nitropyrazole-3-carboxylic acid |
| SMILES | CC(C)(C)c1csc(Cn2cc([N+](=O)[O-])c(C(=O)O)n2)n1 |
| InChI | InChI=1S/C12H14N4O4S/c1-12(2,3)8-6-21-9(13-8)5-15-4-7(16(19)20)10(14-15)11(17)18/h4,6H,5H2,1-3H3,(H,17,18) |
| InChIKey | ABBUSYFHGPBOST-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|