C8H7N5O5 — CID 107345519
1-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-4-nitropyrazole-3-carboxylic acid (PubChem CID 107345519) has the molecular formula C8H7N5O5 and a molecular weight of 253.17 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107345519 |
| Molecular Formula | C8H7N5O5 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 1-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-4-nitropyrazole-3-carboxylic acid |
| SMILES | Cc1nonc1Cn1cc([N+](=O)[O-])c(C(=O)O)n1 |
| InChI | InChI=1S/C8H7N5O5/c1-4-5(11-18-10-4)2-12-3-6(13(16)17)7(9-12)8(14)15/h3H,2H2,1H3,(H,14,15) |
| InChIKey | RERCCHLIEHUGJO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|