C10H10N4O6 — CID 19623178
4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid (PubChem CID 19623178) has the molecular formula C10H10N4O6 and a molecular weight of 282.21 g/mol. Its IUPAC name is 4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid.
| Compound Name | 4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19623178 |
| Molecular Formula | C10H10N4O6 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1nn(Cc2c(C(=O)O)noc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O6/c1-5-6(8(10(15)16)12-20-5)3-13-4-7(14(17)18)9(11-13)19-2/h4H,3H2,1-2H3,(H,15,16) |
| InChIKey | YPRNDPFZYWQHCD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|