C11H7N5O4S — CID 107347083
1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-4-nitropyrazole-3-carboxylic acid (PubChem CID 107347083) has the molecular formula C11H7N5O4S and a molecular weight of 305.28 g/mol. Its IUPAC name is 1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107347083 |
| Molecular Formula | C11H7N5O4S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-4-nitropyrazole-3-carboxylic acid |
| SMILES | Cc1csc2c(-n3cc([N+](=O)[O-])c(C(=O)O)n3)ncnc12 |
| InChI | InChI=1S/C11H7N5O4S/c1-5-3-21-9-7(5)12-4-13-10(9)15-2-6(16(19)20)8(14-15)11(17)18/h2-4H,1H3,(H,17,18) |
| InChIKey | LNNZCDRUHGDRNR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|