C10H9FN4O4S — CID 107353788
1-[(2-fluoro-3-nitrophenyl)methyl]pyrazole-4-sulfonamide (PubChem CID 107353788) has the molecular formula C10H9FN4O4S and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-[(2-fluoro-3-nitrophenyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-[(2-fluoro-3-nitrophenyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 107353788 |
| Molecular Formula | C10H9FN4O4S |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-[(2-fluoro-3-nitrophenyl)methyl]pyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn(Cc2cccc([N+](=O)[O-])c2F)c1 |
| InChI | InChI=1S/C10H9FN4O4S/c11-10-7(2-1-3-9(10)15(16)17)5-14-6-8(4-13-14)20(12,18)19/h1-4,6H,5H2,(H2,12,18,19) |
| InChIKey | NFMWOIQVMKEWIB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|