C15H20BrN3S2 — CID 107354715
4-(4-bromothiophen-2-yl)-2-(1-piperazin-1-ylbutyl)-1,3-thiazole (PubChem CID 107354715) has the molecular formula C15H20BrN3S2 and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-(4-bromothiophen-2-yl)-2-(1-piperazin-1-ylbutyl)-1,3-thiazole.
| Compound Name | 4-(4-bromothiophen-2-yl)-2-(1-piperazin-1-ylbutyl)-1,3-thiazole |
|---|---|
| PubChem CID | 107354715 |
| Molecular Formula | C15H20BrN3S2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 4-(4-bromothiophen-2-yl)-2-(1-piperazin-1-ylbutyl)-1,3-thiazole |
| SMILES | CCCC(c1nc(-c2cc(Br)cs2)cs1)N1CCNCC1 |
| InChI | InChI=1S/C15H20BrN3S2/c1-2-3-13(19-6-4-17-5-7-19)15-18-12(10-21-15)14-8-11(16)9-20-14/h8-10,13,17H,2-7H2,1H3 |
| InChIKey | ZWNMJXKLFYINGJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |