C12H18F3N3S — CID 63342689
2-(1-piperazin-1-ylbutyl)-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 63342689) has the molecular formula C12H18F3N3S and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-(1-piperazin-1-ylbutyl)-4-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-(1-piperazin-1-ylbutyl)-4-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 63342689 |
| Molecular Formula | C12H18F3N3S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(1-piperazin-1-ylbutyl)-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | CCCC(c1nc(C(F)(F)F)cs1)N1CCNCC1 |
| InChI | InChI=1S/C12H18F3N3S/c1-2-3-9(18-6-4-16-5-7-18)11-17-10(8-19-11)12(13,14)15/h8-9,16H,2-7H2,1H3 |
| InChIKey | CGIRKUFZURLLKR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |