C16H23N3S2 — CID 63342178
5-methyl-2-(1-piperazin-1-ylbutyl)-4-thiophen-2-yl-1,3-thiazole (PubChem CID 63342178) has the molecular formula C16H23N3S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 5-methyl-2-(1-piperazin-1-ylbutyl)-4-thiophen-2-yl-1,3-thiazole.
| Compound Name | 5-methyl-2-(1-piperazin-1-ylbutyl)-4-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 63342178 |
| Molecular Formula | C16H23N3S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-methyl-2-(1-piperazin-1-ylbutyl)-4-thiophen-2-yl-1,3-thiazole |
| SMILES | CCCC(c1nc(-c2cccs2)c(C)s1)N1CCNCC1 |
| InChI | InChI=1S/C16H23N3S2/c1-3-5-13(19-9-7-17-8-10-19)16-18-15(12(2)21-16)14-6-4-11-20-14/h4,6,11,13,17H,3,5,7-10H2,1-2H3 |
| InChIKey | FXIUUTJCCONDJR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |