C12H18N4O3S — CID 107356148
N-(3-sulfamoylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356148) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(3-sulfamoylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-(3-sulfamoylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356148 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(3-sulfamoylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)C1CNc2ccccc2N1 |
| InChI | InChI=1S/C12H18N4O3S/c13-20(18,19)7-3-6-14-12(17)11-8-15-9-4-1-2-5-10(9)16-11/h1-2,4-5,11,15-16H,3,6-8H2,(H,14,17)(H2,13,18,19) |
| InChIKey | STIYJNXDEUXOBT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|