C14H21N3O3S — CID 106339564
N-[3-(methanesulfonamido)propyl]-1,2,3,4-tetrahydroquinoline-2-carboxamide (PubChem CID 106339564) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)propyl]-1,2,3,4-tetrahydroquinoline-2-carboxamide.
| Compound Name | N-[3-(methanesulfonamido)propyl]-1,2,3,4-tetrahydroquinoline-2-carboxamide |
|---|---|
| PubChem CID | 106339564 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[3-(methanesulfonamido)propyl]-1,2,3,4-tetrahydroquinoline-2-carboxamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)C1CCc2ccccc2N1 |
| InChI | InChI=1S/C14H21N3O3S/c1-21(19,20)16-10-4-9-15-14(18)13-8-7-11-5-2-3-6-12(11)17-13/h2-3,5-6,13,16-17H,4,7-10H2,1H3,(H,15,18) |
| InChIKey | VHDJUFPQUVVXFK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|