C16H26N2S — CID 107364883
N'-benzyl-N'-(2-methylthian-3-yl)propane-1,3-diamine (PubChem CID 107364883) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is N'-benzyl-N'-(2-methylthian-3-yl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(2-methylthian-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107364883 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N'-benzyl-N'-(2-methylthian-3-yl)propane-1,3-diamine |
| SMILES | CC1SCCCC1N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C16H26N2S/c1-14-16(9-5-12-19-14)18(11-6-10-17)13-15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-13,17H2,1H3 |
| InChIKey | XZUPTGJXDYJXBB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |