C18H28N2 — CID 106511543
N'-benzyl-N'-spiro[3.5]nonan-3-ylethane-1,2-diamine (PubChem CID 106511543) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N'-benzyl-N'-spiro[3.5]nonan-3-ylethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-spiro[3.5]nonan-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 106511543 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N'-benzyl-N'-spiro[3.5]nonan-3-ylethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)C1CCC12CCCCC2 |
| InChI | InChI=1S/C18H28N2/c19-13-14-20(15-16-7-3-1-4-8-16)17-9-12-18(17)10-5-2-6-11-18/h1,3-4,7-8,17H,2,5-6,9-15,19H2 |
| InChIKey | UERKEKBEKAZINQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |