C22H25NO3 — CID 10736663
cis-(1S,3S)-N-benzyl-3-formyl-N-[(4-methoxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 10736663) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is cis-(1S,3S)-N-benzyl-3-formyl-N-[(4-methoxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,3S)-N-benzyl-3-formyl-N-[(4-methoxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 10736663 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | cis-(1S,3S)-N-benzyl-3-formyl-N-[(4-methoxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(CN(Cc2ccccc2)C(=O)[C@H]2[C@H](C=O)C2(C)C)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-22(2)19(15-24)20(22)21(25)23(13-16-7-5-4-6-8-16)14-17-9-11-18(26-3)12-10-17/h4-12,15,19-20H,13-14H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | FTULLINZPYKAMN-VQTJNVASSA-N |
| XLogP | 3.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|