C19H21NO5S — CID 139625464
(2R,3R)-N-(benzenesulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-methyloxirane-2-carboxamide (PubChem CID 139625464) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2R,3R)-N-(benzenesulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-methyloxirane-2-carboxamide.
| Compound Name | (2R,3R)-N-(benzenesulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-methyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 139625464 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (2R,3R)-N-(benzenesulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-methyloxirane-2-carboxamide |
| SMILES | COc1ccc(CN(CS(=O)(=O)c2ccccc2)C(=O)[C@@H]2O[C@@H]2C)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-14-18(25-14)19(21)20(12-15-8-10-16(24-2)11-9-15)13-26(22,23)17-6-4-3-5-7-17/h3-11,14,18H,12-13H2,1-2H3/t14-,18-/m1/s1 |
| InChIKey | LNTUGTAIJQMKHZ-RDTXWAMCSA-N |
| XLogP | 2.24 |
| TPSA | 76.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|