C21H23NO6 — CID 139625459
[(2,4-dimethoxyphenyl)methyl-[(2R,3R)-3-methyloxirane-2-carbonyl]amino]methyl benzoate (PubChem CID 139625459) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is [(2,4-dimethoxyphenyl)methyl-[(2R,3R)-3-methyloxirane-2-carbonyl]amino]methyl benzoate.
| Compound Name | [(2,4-dimethoxyphenyl)methyl-[(2R,3R)-3-methyloxirane-2-carbonyl]amino]methyl benzoate |
|---|---|
| PubChem CID | 139625459 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [(2,4-dimethoxyphenyl)methyl-[(2R,3R)-3-methyloxirane-2-carbonyl]amino]methyl benzoate |
| SMILES | COc1ccc(CN(COC(=O)c2ccccc2)C(=O)[C@@H]2O[C@@H]2C)c(OC)c1 |
| InChI | InChI=1S/C21H23NO6/c1-14-19(28-14)20(23)22(13-27-21(24)15-7-5-4-6-8-15)12-16-9-10-17(25-2)11-18(16)26-3/h4-11,14,19H,12-13H2,1-3H3/t14-,19-/m1/s1 |
| InChIKey | LEHZZZICSLVWHS-AUUYWEPGSA-N |
| XLogP | 2.63 |
| TPSA | 77.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|