C17H25NO4S — CID 57140505
(2R)-N-(tert-butylsulfanylmethyl)-N-[(2,4-dimethoxyphenyl)methyl]oxirane-2-carboxamide (PubChem CID 57140505) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is (2R)-N-(tert-butylsulfanylmethyl)-N-[(2,4-dimethoxyphenyl)methyl]oxirane-2-carboxamide.
| Compound Name | (2R)-N-(tert-butylsulfanylmethyl)-N-[(2,4-dimethoxyphenyl)methyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 57140505 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2R)-N-(tert-butylsulfanylmethyl)-N-[(2,4-dimethoxyphenyl)methyl]oxirane-2-carboxamide |
| SMILES | COc1ccc(CN(CSC(C)(C)C)C(=O)[C@H]2CO2)c(OC)c1 |
| InChI | InChI=1S/C17H25NO4S/c1-17(2,3)23-11-18(16(19)15-10-22-15)9-12-6-7-13(20-4)8-14(12)21-5/h6-8,15H,9-11H2,1-5H3/t15-/m1/s1 |
| InChIKey | PVLGODUXRWENHD-OAHLLOKOSA-N |
| XLogP | 2.92 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|