C10H12N2O5 — CID 107369165
3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107369165) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369165 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(NCC1CCCO1)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C10H12N2O5/c13-9(11-5-6-2-1-3-16-6)7-4-8(10(14)15)17-12-7/h4,6H,1-3,5H2,(H,11,13)(H,14,15) |
| InChIKey | DPOYKPJSXKINFJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |