3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid

C10H12N2O5 — CID 107369165

IUPAC3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid
SMILESO=C(NCC1CCCO1)c1cc(C(=O)O)on1
InChIInChI=1S/C10H12N2O5/c13-9(11-5-6-2-1-3-16-6)7-4-8(10(14)15)17-12-7/h4,6H,1-3,5H2,(H,11,13)(H,14,15)
InChIKeyDPOYKPJSXKINFJ-UHFFFAOYSA-N
MW240.21 g/mol
LogP0.28
Rot. Bonds4

About 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid

3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107369165) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid
PubChem CID107369165
Molecular FormulaC10H12N2O5
Molecular Weight240.21 g/mol
Exact Mass240.07
IUPAC Name3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid
SMILESO=C(NCC1CCCO1)c1cc(C(=O)O)on1
InChIInChI=1S/C10H12N2O5/c13-9(11-5-6-2-1-3-16-6)7-4-8(10(14)15)17-12-7/h4,6H,1-3,5H2,(H,11,13)(H,14,15)
InChIKeyDPOYKPJSXKINFJ-UHFFFAOYSA-N
XLogP0.28
TPSA101.66 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.21
LogP ≤ 50.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid (CID 107369165) is 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid is O=C(NCC1CCCO1)c1cc(C(=O)O)on1.
What is the InChIKey of 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is DPOYKPJSXKINFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O5/c13-9(11-5-6-2-1-3-16-6)7-4-8(10(14)15)17-12-7/h4,6H,1-3,5H2,(H,11,13)(H,14,15).
What are the key properties of 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid?
3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 240.21 g/mol, XLogP of 0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-2-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107369165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).