C11H14N2O5 — CID 107369661
3-(oxan-4-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107369661) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 3-(oxan-4-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(oxan-4-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369661 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-(oxan-4-ylmethylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(NCC1CCOCC1)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C11H14N2O5/c14-10(8-5-9(11(15)16)18-13-8)12-6-7-1-3-17-4-2-7/h5,7H,1-4,6H2,(H,12,14)(H,15,16) |
| InChIKey | XJUAUFNYUILGCG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |