C9H12N2O4S — CID 107369677
3-(3-methylsulfanylpropylcarbamoyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107369677) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-(3-methylsulfanylpropylcarbamoyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3-methylsulfanylpropylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369677 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-(3-methylsulfanylpropylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CSCCCNC(=O)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C9H12N2O4S/c1-16-4-2-3-10-8(12)6-5-7(9(13)14)15-11-6/h5H,2-4H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | VJQUNPGLTYTQIL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|