C11H16N2O4 — CID 107370011
3-(3,3-dimethylbutylcarbamoyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107370011) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-(3,3-dimethylbutylcarbamoyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3,3-dimethylbutylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107370011 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-(3,3-dimethylbutylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CC(C)(C)CCNC(=O)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,3)4-5-12-9(14)7-6-8(10(15)16)17-13-7/h6H,4-5H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | RRTALVMBCHZYHE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |