C17H19ClFNO — CID 107370388
1-(3-chloro-5-fluorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol (PubChem CID 107370388) has the molecular formula C17H19ClFNO and a molecular weight of 307.80 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol.
| Compound Name | 1-(3-chloro-5-fluorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 107370388 |
| Molecular Formula | C17H19ClFNO |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol |
| SMILES | Cc1cc2c(n1-c1cc(F)cc(Cl)c1)CC(C)(C)CC2O |
| InChI | InChI=1S/C17H19ClFNO/c1-10-4-14-15(8-17(2,3)9-16(14)21)20(10)13-6-11(18)5-12(19)7-13/h4-7,16,21H,8-9H2,1-3H3 |
| InChIKey | UIGKLUQMZVDZBC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|