C11H8ClN3O3S — CID 107371771
methyl 3-[(5-chloropyrazine-2-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 107371771) has the molecular formula C11H8ClN3O3S and a molecular weight of 297.72 g/mol. Its IUPAC name is methyl 3-[(5-chloropyrazine-2-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(5-chloropyrazine-2-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 107371771 |
| Molecular Formula | C11H8ClN3O3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | methyl 3-[(5-chloropyrazine-2-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C11H8ClN3O3S/c1-18-11(17)9-6(2-3-19-9)15-10(16)7-4-14-8(12)5-13-7/h2-5H,1H3,(H,15,16) |
| InChIKey | WWFKEASMSRLGAZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |